
CAS 1261939-13-2
:4-Pyridinol, 2-(3,5-dichlorophenyl)-
Description:
4-Pyridinol, 2-(3,5-dichlorophenyl)-, identified by CAS number 1261939-13-2, is an organic compound characterized by its pyridine ring structure substituted with a hydroxyl group and a dichlorophenyl group. This compound typically exhibits properties associated with both the pyridine and phenolic functionalities, including potential solubility in polar solvents and moderate lipophilicity due to the presence of the chlorinated aromatic ring. The dichlorophenyl substituent may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of chlorine atoms can influence the compound's reactivity and stability, as well as its interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. As with many organic compounds, safety and handling precautions are essential, given the potential toxicity associated with chlorinated aromatic compounds. Overall, 4-Pyridinol, 2-(3,5-dichlorophenyl)- represents a class of compounds that may exhibit diverse chemical behavior and biological activity.
Formula:C11H7Cl2NO
InChI:InChI=1S/C11H7Cl2NO/c12-8-3-7(4-9(13)5-8)11-6-10(15)1-2-14-11/h1-6H,(H,14,15)
InChI key:InChIKey=LENJUJUFHCEVNG-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(Cl)C1)C2=CC(O)=CC=N2
Synonyms:- 2-(3,5-Dichlorophenyl)pyridin-4-ol
- 4-Pyridinol, 2-(3,5-dichlorophenyl)-
- 2-(3,5-Dichlorophenyl)pyridin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.