CAS 1261939-16-5

5-Hydroxy-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Hydroxy-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1261939-16-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including hydroxyl (-OH) and carboxylic acid (-COOH) groups, which contribute to its chemical reactivity and solubility in polar solvents. The presence of hydroxymethyl groups enhances its potential for further chemical modifications. It is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, and may participate in hydrogen bonding due to its hydroxyl groups. The carboxylic acid moiety can engage in acid-base reactions, making it a versatile compound in organic synthesis and potential applications in pharmaceuticals or materials science. Its specific applications and behavior would depend on the context of its use, including interactions with other chemical species and its stability under various conditions.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c15-8-9-1-3-10(4-2-9)11-5-12(14(17)18)7-13(16)6-11/h1-7,15-16H,8H2,(H,17,18)

InChI key: InChIKey=NGRZEQNHIBSFKA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(O)C1)C2=CC=C(CO)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-hydroxy-4′-(hydroxymethyl)-
• 5-Hydroxy-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid