CymitQuimica logo

CAS 1261939-20-1

:

5-Fluoro-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
5-Fluoro-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The hydroxymethyl group (-CH2OH) adds a polar functional group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The fluorine atom introduces electronegativity, which can influence the compound's reactivity and biological activity. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interaction with other chemical entities. Overall, the unique combination of functional groups and structural characteristics makes it a compound of interest in various chemical and biological research fields.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c15-13-6-11(5-12(7-13)14(17)18)10-3-1-9(8-16)2-4-10/h1-7,16H,8H2,(H,17,18)
InChI key:InChIKey=ZAJDAMJXKIAAMZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(CO)C=C2
Synonyms:
  • 5-Fluoro-4′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-4′-(hydroxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.