CymitQuimica logo

CAS 1261939-40-5

:

5-(2,3-Dichlorophenyl)-3-pyridinol

Description:
5-(2,3-Dichlorophenyl)-3-pyridinol is a chemical compound characterized by its pyridine ring and a dichlorophenyl substituent. It features a pyridinol structure, which includes a hydroxyl group (-OH) attached to the third position of the pyridine ring, contributing to its potential as a weak acid. The presence of two chlorine atoms on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of agrochemicals or as a building block in organic synthesis. Its molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the dichlorophenyl group can impart unique electronic properties, potentially affecting the compound's reactivity and stability. As with many chemical substances, safety data and handling precautions should be observed due to the presence of chlorine, which can pose environmental and health risks.
Formula:C11H7Cl2NO
InChI:InChI=1S/C11H7Cl2NO/c12-10-3-1-2-9(11(10)13)7-4-8(15)6-14-5-7/h1-6,15H
InChI key:InChIKey=ZISLNMBPBIRIJR-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(O)C=NC2)C=CC=C1Cl
Synonyms:
  • 5-(2,3-Dichlorophenyl)-3-pyridinol
  • 3-Pyridinol, 5-(2,3-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.