CAS 1261939-47-2

3-(5-Hydroxy-3-pyridinyl)-N,N-dimethylbenzamide

Description:

3-(5-Hydroxy-3-pyridinyl)-N,N-dimethylbenzamide, identified by its CAS number 1261939-47-2, is a chemical compound that features a benzamide structure with a dimethylamino group and a hydroxyl-substituted pyridine moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the pyridine ring and the hydroxyl group, which can participate in hydrogen bonding. The dimethylamino group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The compound may exhibit solubility in organic solvents and varying solubility in water, depending on the pH and the presence of other functional groups. Its structural features suggest that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. As with many organic compounds, its stability, reactivity, and biological activity would be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1S/C14H14N2O2/c1-16(2)14(18)11-5-3-4-10(6-11)12-7-13(17)9-15-8-12/h3-9,17H,1-2H3

InChI key: InChIKey=FPQVGMMQGYNQDN-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C=1C=C(C=CC1)C=2C=C(O)C=NC2

Synonyms:

• 3-(5-Hydroxy-3-pyridinyl)-N,N-dimethylbenzamide
• Benzamide, 3-(5-hydroxy-3-pyridinyl)-N,N-dimethyl-