CAS 1261939-52-9

N-Ethyl-2-fluoro-4-(4-hydroxy-2-pyridinyl)benzamide

Description:

N-Ethyl-2-fluoro-4-(4-hydroxy-2-pyridinyl)benzamide is a chemical compound characterized by its specific structural features, including an ethyl group, a fluorine atom, and a hydroxyl-substituted pyridine moiety. This compound belongs to the class of benzamides, which are known for their diverse biological activities. The presence of the fluorine atom typically enhances the lipophilicity and metabolic stability of the molecule, potentially influencing its pharmacokinetic properties. The hydroxyl group on the pyridine ring can participate in hydrogen bonding, which may affect the compound's interactions with biological targets. Additionally, the overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The compound's unique combination of functional groups may also contribute to its solubility and reactivity, making it a subject of interest for further research in drug design and synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₃FN₂O₂

InChI: InChI=1S/C14H13FN2O2/c1-2-16-14(19)11-4-3-9(7-12(11)15)13-8-10(18)5-6-17-13/h3-8H,2H2,1H3,(H,16,19)(H,17,18)

InChI key: InChIKey=ZYYUCCFIPIOCKD-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(NCC)=O)C2=CC(O)=CC=N2

Synonyms:

• N-Ethyl-2-fluoro-4-(4-hydroxy-2-pyridinyl)benzamide
• Benzamide, N-ethyl-2-fluoro-4-(4-hydroxy-2-pyridinyl)-