CAS 1261940-48-0

4′-Methyl 3′,5-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate

Description:

4′-Methyl 3′,5-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of methyl and difluoro substituents on the biphenyl framework significantly influences its chemical properties, including its reactivity and solubility. The dicarboxylate functional groups indicate that the compound contains two carboxylate moieties, which can participate in various chemical reactions, such as esterification or salt formation. The fluorine atoms contribute to the compound's polarity and can enhance its biological activity or interaction with other molecules. This compound may be of interest in fields such as pharmaceuticals, agrochemicals, or materials science due to its potential applications in drug design or as a building block in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for precise applications.

Formula: C₁₅H₁₀F₂O₄

InChI: InChI=1S/C15H10F2O4/c1-21-15(20)11-4-2-8(6-13(11)17)12-7-9(16)3-5-10(12)14(18)19/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=QVSHNEFHALSPFR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(F)C=C1)C2=CC(F)=C(C(OC)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-2,4′-dicarboxylic acid, 3′,5-difluoro-, 4′-methyl ester
• 4′-Methyl 3′,5-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate