CymitQuimica logo

CAS 1261940-80-0

:

4-(3,5-Dimethylphenyl)-2(1H)-pyridinone

Description:
4-(3,5-Dimethylphenyl)-2(1H)-pyridinone, identified by its CAS number 1261940-80-0, is an organic compound characterized by its pyridinone structure, which features a pyridine ring fused with a ketone group. This compound exhibits a molecular structure that includes a dimethyl-substituted phenyl group, contributing to its unique chemical properties. Typically, compounds of this nature may display moderate to high lipophilicity due to the presence of aromatic rings, which can influence their solubility in organic solvents. The presence of the pyridinone moiety suggests potential biological activity, as many pyridinone derivatives are known for their pharmacological properties. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the reactivity of both the pyridine and phenyl components. Its specific applications and behavior in chemical reactions would depend on the functional groups and substituents present, making it a subject of interest in medicinal chemistry and organic synthesis.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-9-5-10(2)7-12(6-9)11-3-4-14-13(15)8-11/h3-8H,1-2H3,(H,14,15)
InChI key:InChIKey=SFTWTWGZLVGTBG-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(C)C1)C2=CC(=O)NC=C2
Synonyms:
  • 4-(3,5-Dimethylphenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 4-(3,5-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.