CAS 1261940-97-9

3′-Fluoro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid

Description:

3′-Fluoro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The fluorine atom at the 3′ position and the methyl group at the 4′ position on the biphenyl framework contribute to the compound's unique chemical properties, potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and material science. Its molecular interactions can be affected by the electron-withdrawing nature of the fluorine atom and the electron-donating characteristics of the methyl group. Overall, 3′-Fluoro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid represents a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1S/C14H11FO2/c1-9-6-7-10(8-13(9)15)11-4-2-3-5-12(11)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=GQJRYTXTCLCBMJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1)C2=CC(F)=C(C)C=C2

Synonyms:

• 3′-Fluoro-4′-methyl[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 3′-fluoro-4′-methyl-
• 2-(3-Fluoro-4-methylphenyl)benzoic acid

2-(3-Fluoro-4-methylphenyl)benzoic acid

CAS: 1261940-97-9

Formula: C₁₄H₁₁FO₂

Molecular weight: 230.2343

Ref: IN-DA000S72