
CAS 1261941-14-3
:4-Fluoro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid
Description:
4-Fluoro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which features a carboxylic acid functional group and a sulfonyl group attached to a pyrrolidine ring. The presence of the fluorine atom at the para position of the biphenyl moiety contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the biphenyl structure may impart hydrophobic characteristics. The sulfonyl group enhances the compound's ability to form hydrogen bonds, which can affect its pharmacokinetic properties. Given its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its precise applications and biological activity would depend on further studies, including its interaction with receptors or enzymes, as well as its overall toxicity and efficacy profiles.
Formula:C17H16FNO4S
InChI:InChI=1S/C17H16FNO4S/c18-13-5-8-15(16(11-13)17(20)21)12-3-6-14(7-4-12)24(22,23)19-9-1-2-10-19/h3-8,11H,1-2,9-10H2,(H,20,21)
InChI key:InChIKey=NIZXEAHGMQOBKO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(F)=C1)C2=CC=C(S(=O)(=O)N3CCCC3)C=C2
Synonyms:- 4-Fluoro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 4-fluoro-4′-(1-pyrrolidinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.