CAS 1261941-22-3

4′-Chloro-3′-cyano[1,1′-biphenyl]-3-carboxylic acid

Description:

4′-Chloro-3′-cyano[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a chloro group and a cyano group, which contribute to its reactivity and potential applications in various chemical processes. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. The presence of the cyano group suggests potential utility in synthetic organic chemistry, particularly in the formation of nitriles or as a building block for more complex molecules. Additionally, the chlorine substituent can influence the compound's electronic properties and solubility. Overall, this compound may be of interest in fields such as pharmaceuticals, agrochemicals, or materials science due to its unique structural features and functional groups.

Formula: C₁₄H₈ClNO₂

InChI: InChI=1S/C14H8ClNO2/c15-13-5-4-10(7-12(13)8-16)9-2-1-3-11(6-9)14(17)18/h1-7H,(H,17,18)

InChI key: InChIKey=NEQVPYLTBMOJDG-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1Cl)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 4′-Chloro-3′-cyano[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4′-chloro-3′-cyano-