
CAS 1261941-24-5
:3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid
Description:
3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which features a carboxylic acid functional group and a sulfonamide moiety. The presence of the chlorine atom at the 3-position and the pyrrolidinylsulfonyl group at the 4′-position contributes to its unique chemical properties and potential biological activity. This compound is likely to exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, while the biphenyl structure may impart hydrophobic characteristics. The sulfonamide group can enhance its interaction with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the biphenyl ring, which may affect its pharmacokinetic properties. Overall, this compound represents a class of molecules that could be explored for therapeutic applications.
Formula:C17H16ClNO4S
InChI:InChI=1S/C17H16ClNO4S/c18-15-5-3-4-14(16(15)17(20)21)12-6-8-13(9-7-12)24(22,23)19-10-1-2-11-19/h3-9H,1-2,10-11H2,(H,20,21)
InChI key:InChIKey=KLICVRJJSDXBSY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1Cl)C2=CC=C(S(=O)(=O)N3CCCC3)C=C2
Synonyms:- 3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 3-chloro-4′-(1-pyrrolidinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.