
CAS 1261941-27-8
:5-(4-Fluoro-3-methylphenyl)-3-pyridinol
Description:
5-(4-Fluoro-3-methylphenyl)-3-pyridinol, identified by its CAS number 1261941-27-8, is a chemical compound characterized by its unique structural features. It consists of a pyridine ring substituted with a hydroxyl group at the 3-position and a phenyl group at the 5-position, where the phenyl group is further substituted with a fluorine atom and a methyl group. This compound exhibits properties typical of both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the hydroxyl group may participate in hydrogen bonding, affecting solubility and reactivity. Such structural characteristics suggest that 5-(4-Fluoro-3-methylphenyl)-3-pyridinol could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific applications and biological activities would depend on further empirical studies and evaluations.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c1-8-4-9(2-3-12(8)13)10-5-11(15)7-14-6-10/h2-7,15H,1H3
InChI key:InChIKey=WDJRMUZTXRUIDB-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1F)C=2C=C(O)C=NC2
Synonyms:- 5-(4-Fluoro-3-methylphenyl)-3-pyridinol
- 3-Pyridinol, 5-(4-fluoro-3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.