CymitQuimica logo

CAS 1261941-32-5

:

5-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-thiophenecarboxaldehyde

Description:
5-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-thiophenecarboxaldehyde is a chemical compound characterized by its unique structural features, which include a pyridine ring fused with a thiophene moiety. This compound typically exhibits properties associated with both heterocyclic systems, such as potential biological activity and reactivity due to the presence of the aldehyde functional group. The pyridine component contributes to its electron-withdrawing characteristics, while the thiophene ring can enhance its aromatic stability and influence its solubility in organic solvents. The presence of the carbonyl group in the pyridine ring suggests potential for further chemical reactivity, including nucleophilic addition or condensation reactions. This compound may be of interest in medicinal chemistry for its potential pharmacological properties, as many derivatives of pyridine and thiophene are known to exhibit various biological activities. Overall, its unique structure and functional groups make it a candidate for further research in organic synthesis and drug development.
Formula:C10H7NO2S
InChI:InChI=1S/C10H7NO2S/c12-6-7-3-4-9(14-7)8-2-1-5-11-10(8)13/h1-6H,(H,11,13)
InChI key:InChIKey=QTMFBSVYDIUKPT-UHFFFAOYSA-N
SMILES:O=C1C(C=2SC(C=O)=CC2)=CC=CN1
Synonyms:
  • 5-(1,2-Dihydro-2-oxo-3-pyridinyl)-2-thiophenecarboxaldehyde
  • 2-Thiophenecarboxaldehyde, 5-(1,2-dihydro-2-oxo-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.