CAS 1261942-02-2

4′-Fluoro-4-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile

Description:

4′-Fluoro-4-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position of one phenyl ring, a hydroxyl group, and a methoxy group at the meta position of the other ring contributes to its unique chemical properties. The carbonitrile functional group introduces a nitrile (-C≡N) moiety, which can influence the compound's reactivity and polarity. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its solubility, stability, and reactivity can vary based on the functional groups present, and it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, the combination of functional groups and the biphenyl framework provides a versatile platform for further chemical modifications and applications.

Formula: C₁₄H₁₀FNO₂

InChI: InChI=1S/C14H10FNO2/c1-18-14-7-10(2-4-12(14)15)9-3-5-13(17)11(6-9)8-16/h2-7,17H,1H3

InChI key: InChIKey=GETHJGQNRDTWTJ-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1O)C2=CC(OC)=C(F)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 4′-fluoro-4-hydroxy-3′-methoxy-
• 4′-Fluoro-4-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile