CAS 1261942-05-5

5′-Fluoro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile

Description:

5′-Fluoro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with various functional groups. The presence of a fluorine atom at the 5′ position and a hydroxyl group at the 5 position contributes to its potential reactivity and biological activity. The methoxy group at the 2′ position enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The carbonitrile group at the 3 position introduces a polar functional group that can participate in hydrogen bonding and may affect the compound's interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could modulate biological activity. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for practical applications.

Formula: C₁₄H₁₀FNO₂

InChI: InChI=1S/C14H10FNO2/c1-18-14-3-2-11(15)7-13(14)10-4-9(8-16)5-12(17)6-10/h2-7,17H,1H3

InChI key: InChIKey=XVAJRHFJCWOCMW-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(C#N)=CC(O)=C2)C=C(F)C=C1

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 5′-fluoro-5-hydroxy-2′-methoxy-
• 5′-Fluoro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile