
CAS 1261942-07-7
:2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carbonitrile
Description:
2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a hydroxyl group at the 3 position contributes to its reactivity and potential applications in various chemical processes. The methyl group at the 4′ position adds to the compound's hydrophobic characteristics, while the carbonitrile functional group at the 4 position introduces a polar element, enhancing its solubility in certain solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and its unique functional groups may influence its chemical behavior, stability, and reactivity. Overall, 2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carbonitrile is a complex molecule with diverse properties that can be explored for various applications in organic synthesis and medicinal chemistry.
Formula:C14H10ClNO
InChI:InChI=1S/C14H10ClNO/c1-9-2-5-12(13(15)6-9)10-3-4-11(8-16)14(17)7-10/h2-7,17H,1H3
InChI key:InChIKey=HMIHNIBTDLFHFU-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C)=C1)C2=CC(O)=C(C#N)C=C2
Synonyms:- 2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carbonitrile
- [1,1′-Biphenyl]-4-carbonitrile, 2′-chloro-3-hydroxy-4′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.