
CAS 1261942-15-7
:5-Fluoro-3′-hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid
Description:
5-Fluoro-3′-hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a fluorine atom, a hydroxyl group, and a trifluoromethoxy group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydroxyl group can participate in hydrogen bonding, potentially affecting solubility and reactivity. The trifluoromethoxy group is known for its electron-withdrawing properties, which can stabilize certain reactive intermediates. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific interactions and reactivity would depend on the surrounding environment and the presence of other functional groups in a given chemical context.
Formula:C14H8F4O4
InChI:InChI=1S/C14H8F4O4/c15-10-2-7(1-9(3-10)13(20)21)8-4-11(19)6-12(5-8)22-14(16,17)18/h1-6,19H,(H,20,21)
InChI key:InChIKey=GHGJYRSKYARZGT-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC(C(O)=O)=CC(F)=C2
Synonyms:- 5-Fluoro-3′-hydroxy-5′-(trifluoromethoxy)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-3′-hydroxy-5′-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.