CymitQuimica logo

CAS 1261942-41-9

:

3′-(Phenylmethoxy)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol

Description:
3′-(Phenylmethoxy)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl, contributing to its potential as a phenolic compound. The presence of a phenylmethoxy group and a trifluoromethoxy group enhances its chemical reactivity and solubility properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The trifluoromethoxy group, in particular, can influence the compound's electronic properties and lipophilicity, which may affect its biological activity. Additionally, the compound's molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can impact its interactions with other molecules. Overall, this compound's unique functional groups and biphenyl framework contribute to its potential utility in chemical synthesis and research.
Formula:C20H15F3O3
InChI:InChI=1S/C20H15F3O3/c21-20(22,23)26-19-11-16(9-17(24)12-19)15-7-4-8-18(10-15)25-13-14-5-2-1-3-6-14/h1-12,24H,13H2
InChI key:InChIKey=HIBLTDFNKQNCIF-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC(OCC3=CC=CC=C3)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 3′-(phenylmethoxy)-5-(trifluoromethoxy)-
  • 3′-(Phenylmethoxy)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.