CAS 1261942-55-5

2′,5′-Difluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:

2′,5′-Difluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms and a nitro group at specific positions on the biphenyl framework contributes to its unique chemical properties, including increased electronegativity and potential reactivity. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound may exhibit interesting biological activity due to its structural features, which can influence interactions with biological targets. Additionally, the presence of fluorine atoms often imparts stability and lipophilicity, which can be advantageous in pharmaceutical development. Overall, 2′,5′-Difluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid is a compound of interest in both synthetic chemistry and potential medicinal applications.

Formula: C₁₃H₇F₂NO₄

InChI: InChI=1S/C13H7F2NO4/c14-7-1-4-12(15)11(5-7)10-6-8(16(19)20)2-3-9(10)13(17)18/h1-6H,(H,17,18)

InChI key: InChIKey=HLEPVGRBHNJAAF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=C(F)C=CC(F)=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 2′,5′-difluoro-5-nitro-
• 2′,5′-Difluoro-5-nitro[1,1′-biphenyl]-2-carboxylic acid

2-(2,5-Difluorophenyl)-4-nitrobenzoic acid

CAS: 1261942-55-5

Please enquire for more information about 2-(2,5-Difluorophenyl)-4-nitrobenzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₇F₂NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 279.19 g/mol

Ref: 3D-LAC94255