CAS 1261942-71-5

3,3′-Dichloro-2′-methyl[1,1′-biphenyl]-4-ol

Description:

3,3′-Dichloro-2′-methyl[1,1′-biphenyl]-4-ol, identified by its CAS number 1261942-71-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 3 and 3′ positions and a methyl group at the 2′ position, along with a hydroxyl group (-OH) at the 4 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, which can influence its solubility in organic solvents. The chlorinated and hydroxyl functional groups may impart specific reactivity, making it of interest in various chemical applications, including potential use in pharmaceuticals or agrochemicals. Additionally, the compound's structural features suggest it may participate in hydrogen bonding due to the hydroxyl group, affecting its physical properties such as boiling and melting points. Safety and environmental considerations are essential when handling such chlorinated compounds, as they may pose toxicity risks.

Formula: C₁₃H₁₀Cl₂O

InChI: InChI=1S/C13H10Cl2O/c1-8-10(3-2-4-11(8)14)9-5-6-13(16)12(15)7-9/h2-7,16H,1H3

InChI key: InChIKey=BYXHBMCFRSIGRD-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1Cl)C2=CC(Cl)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 3,3′-dichloro-2′-methyl-
• 3,3′-Dichloro-2′-methyl[1,1′-biphenyl]-4-ol