
CAS 1261942-72-6
:4-Methyl-4′-(phenylmethoxy)[1,1′-biphenyl]-3-ol
Description:
4-Methyl-4′-(phenylmethoxy)[1,1′-biphenyl]-3-ol, identified by its CAS number 1261942-72-6, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl framework, contributing to its classification as a phenolic compound. The presence of a methyl group at the 4-position and a phenylmethoxy group at the 4′-position enhances its molecular complexity and may influence its solubility and reactivity. Typically, such compounds exhibit properties like moderate to high lipophilicity, which can affect their biological activity and interaction with other molecules. The hydroxyl group can participate in hydrogen bonding, potentially impacting the compound's physical properties, such as melting and boiling points. Additionally, the structural features suggest potential applications in pharmaceuticals, materials science, or as intermediates in organic synthesis, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C20H18O2
InChI:InChI=1S/C20H18O2/c1-15-7-8-18(13-20(15)21)17-9-11-19(12-10-17)22-14-16-5-3-2-4-6-16/h2-13,21H,14H2,1H3
InChI key:InChIKey=SODSEKRRRQRWJH-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1C)C2=CC=C(OCC3=CC=CC=C3)C=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 4-methyl-4′-(phenylmethoxy)-
- 4-Methyl-4′-(phenylmethoxy)[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.