CymitQuimica logo

CAS 1261942-73-7

:

2′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-ol

Description:
2′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and a methoxy group at the 5′ position on one of the phenyl rings, along with a hydroxyl group at the 3 position, contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The fluoro substituent may influence the compound's electronic properties and reactivity, potentially affecting its biological activity. Additionally, the methoxy group can provide steric hindrance and alter the compound's lipophilicity. Overall, the combination of these functional groups suggests that 2′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-ol may have applications in medicinal chemistry or materials science, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c1-16-11-5-6-13(14)12(8-11)9-3-2-4-10(15)7-9/h2-8,15H,1H3
InChI key:InChIKey=FIJOGDYQAXUEIN-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OC)=CC1)C2=CC(O)=CC=C2
Synonyms:
  • 2′-Fluoro-5′-methoxy[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 2′-fluoro-5′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.