
CAS 1261942-81-7
:6-(3-Carboxy-5-fluorophenyl)-3-pyridinecarboxylic acid
Description:
6-(3-Carboxy-5-fluorophenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261942-81-7, is a chemical compound characterized by its complex structure that includes both pyridine and aromatic carboxylic acid functionalities. This compound features a pyridine ring substituted with carboxylic acid groups, which contribute to its acidic properties and potential for forming hydrogen bonds. The presence of a fluorine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid groups, making it soluble in polar solvents. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may serve as intermediates or active pharmaceutical ingredients. Additionally, the presence of fluorine can enhance metabolic stability and bioavailability. Overall, this compound's properties make it a subject of interest in various chemical and biological research fields.
Formula:C13H8FNO4
InChI:InChI=1S/C13H8FNO4/c14-10-4-8(3-9(5-10)13(18)19)11-2-1-7(6-15-11)12(16)17/h1-6H,(H,16,17)(H,18,19)
InChI key:InChIKey=GXSMJIHUXWQWME-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC=C(C(O)=O)C=N2
Synonyms:- 6-(3-Carboxy-5-fluorophenyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 6-(3-carboxy-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.