CAS 1261943-44-5

Methyl 4-(4-chloro-3-hydroxyphenyl)-2-thiophenecarboxylate

Description:

Methyl 4-(4-chloro-3-hydroxyphenyl)-2-thiophenecarboxylate is an organic compound characterized by its complex structure, which includes a thiophene ring and a chlorinated phenolic group. The presence of the methyl ester functional group indicates that it can participate in various chemical reactions, such as esterification and hydrolysis. The compound features a chloro substituent, which can influence its reactivity and solubility, while the hydroxy group contributes to its potential as a hydrogen bond donor. The thiophene moiety adds to its aromatic character and may enhance its electronic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, Methyl 4-(4-chloro-3-hydroxyphenyl)-2-thiophenecarboxylate represents a versatile structure with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₂H₉ClO₃S

InChI: InChI=1S/C12H9ClO3S/c1-16-12(15)11-5-8(6-17-11)7-2-3-9(13)10(14)4-7/h2-6,14H,1H3

InChI key: InChIKey=PLPDITLBXQEEPY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(=CS1)C2=CC(O)=C(Cl)C=C2

Synonyms:

• Methyl 4-(4-chloro-3-hydroxyphenyl)-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 4-(4-chloro-3-hydroxyphenyl)-, methyl ester