CymitQuimica logo

CAS 1261943-54-7

:

5-Nitro[1,1′-biphenyl]-2,4′-dicarboxylic acid

Description:
5-Nitro[1,1′-biphenyl]-2,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of nitro and carboxylic acid functional groups significantly influences its chemical properties. The nitro group typically enhances the compound's reactivity and polarity, while the carboxylic acid groups contribute to its acidity and potential for hydrogen bonding. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in polar solvents due to the presence of the carboxylic acid groups. Its molecular structure suggests potential applications in organic synthesis, materials science, or as an intermediate in the production of dyes or pharmaceuticals. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile compound in research and industrial applications. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks.
Formula:C14H9NO6
InChI:InChI=1S/C14H9NO6/c16-13(17)9-3-1-8(2-4-9)12-7-10(15(20)21)5-6-11(12)14(18)19/h1-7H,(H,16,17)(H,18,19)
InChI key:InChIKey=XGNCWPPNCNFYTH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC=C(C(O)=O)C=C2
Synonyms:
  • 5-Nitro[1,1′-biphenyl]-2,4′-dicarboxylic acid
  • [1,1′-Biphenyl]-2,4′-dicarboxylic acid, 5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.