
CAS 1261943-57-0
:2′,4′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
Description:
2′,4′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 4′ positions on one of the phenyl rings contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in electrophilic substitution reactions. The hydroxyl group (-OH) at the 3-position enhances its polarity and can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, the aldehyde functional group (-CHO) at the 4-position introduces reactivity typical of carbonyl compounds, allowing for further chemical transformations. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its specific applications and behavior would depend on the context of its use, including potential roles in synthesis or as a precursor in various chemical reactions.
Formula:C13H8F2O2
InChI:InChI=1S/C13H8F2O2/c14-10-3-4-11(12(15)6-10)8-1-2-9(7-16)13(17)5-8/h1-7,17H
InChI key:InChIKey=PVHLWBKMJWLVPG-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(F)=C1)C2=CC(O)=C(C=O)C=C2
Synonyms:- 2′,4′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
- [1,1′-Biphenyl]-4-carboxaldehyde, 2′,4′-difluoro-3-hydroxy-
- 2′,4′-Difluoro-3-hydroxybiphenyl-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.