CymitQuimica logo

CAS 1261943-80-9

:

3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-methanol

Description:
3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-methanol, identified by its CAS number 1261943-80-9, is an organic compound characterized by the presence of a biphenyl structure with specific functional groups. The molecule features a fluorine atom at the 3′ position and a hydroxyl group at the 5′ position of the biphenyl ring, along with a methanol group at the 4 position. This configuration suggests that the compound may exhibit interesting chemical properties, such as potential hydrogen bonding due to the hydroxyl group and varied reactivity influenced by the electron-withdrawing nature of the fluorine atom. The presence of these functional groups may also impart specific biological activities, making it a candidate for further research in medicinal chemistry or materials science. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, which may affect its applications in various chemical processes or as a potential pharmaceutical agent.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c14-12-5-11(6-13(16)7-12)10-3-1-9(8-15)2-4-10/h1-7,15-16H,8H2
InChI key:InChIKey=PEBQCHKNBANCOQ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(O)C1)C2=CC=C(CO)C=C2
Synonyms:
  • 3′-Fluoro-5′-hydroxy[1,1′-biphenyl]-4-methanol
  • [1,1′-Biphenyl]-4-methanol, 3′-fluoro-5′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.