CymitQuimica logo

CAS 1261943-81-0

:

3-(1-Naphthalenyl)-4-pyridinecarboxylic acid

Description:
3-(1-Naphthalenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261943-81-0, is an organic compound characterized by the presence of both a naphthalene and a pyridine moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for hydrogen bonding. The naphthalene ring provides a hydrophobic character, while the pyridine ring introduces basicity due to the nitrogen atom, allowing for various interactions in biological and chemical systems. This compound may exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics or as a fluorescent probe. Additionally, its structural features suggest potential for coordination with metal ions, which could be relevant in catalysis or materials science. Overall, the unique combination of aromatic systems and functional groups in 3-(1-Naphthalenyl)-4-pyridinecarboxylic acid makes it a compound of interest in both synthetic and applied chemistry.
Formula:C16H11NO2
InChI:InChI=1S/C16H11NO2/c18-16(19)14-8-9-17-10-15(14)13-7-3-5-11-4-1-2-6-12(11)13/h1-10H,(H,18,19)
InChI key:InChIKey=QDOVIVHJOWELQJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C=2C3=C(C=CC2)C=CC=C3)=CN=CC1
Synonyms:
  • 3-(1-Naphthalenyl)-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 3-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.