
CAS 1261943-82-1
:2′,6′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
Description:
2′,6′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 6′ positions introduces significant electronegativity, influencing the compound's reactivity and polarity. The hydroxy group at the 3-position contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. Additionally, the aldehyde functional group at the 4-position is reactive, making it susceptible to nucleophilic attack and oxidation. This compound may exhibit interesting properties such as fluorescence or photochemical activity due to its aromatic nature and substituents. Its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H8F2O2
InChI:InChI=1S/C13H8F2O2/c14-10-2-1-3-11(15)13(10)8-4-5-9(7-16)12(17)6-8/h1-7,17H
InChI key:InChIKey=CZCDSCOHHORIOR-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC=C1)C2=CC(O)=C(C=O)C=C2
Synonyms:- 2′,6′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
- [1,1′-Biphenyl]-4-carboxaldehyde, 2′,6′-difluoro-3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.