
CAS 1261943-95-6
:4-[3-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid
Description:
4-[3-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261943-95-6, is an organic compound characterized by its complex structure that includes both a pyridine and a phenolic moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the hydroxymethyl group on the phenyl ring enhances its solubility in polar solvents and may influence its biological activity. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, its unique combination of functional groups may allow for interactions with various biological targets, making it a candidate for further research in medicinal chemistry. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this substance represents a valuable area of study within organic and medicinal chemistry.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c15-8-9-2-1-3-10(6-9)11-4-5-14-7-12(11)13(16)17/h1-7,15H,8H2,(H,16,17)
InChI key:InChIKey=RUMXIBWQGLVPHJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CC=NC1)C2=CC(CO)=CC=C2
Synonyms:- 3-Pyridinecarboxylic acid, 4-[3-(hydroxymethyl)phenyl]-
- 4-[3-(Hydroxymethyl)phenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.