CymitQuimica logo

CAS 1261944-04-0

:

4-(3-Formyl-4-hydroxyphenyl)-2-thiophenecarboxylic acid

Description:
4-(3-Formyl-4-hydroxyphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its complex structure, which includes a thiophene ring and a phenolic moiety with an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may form salts or esters. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. Additionally, the aldehyde group can engage in condensation reactions, making it versatile in organic synthesis. This compound may also exhibit biological activity, which is common in compounds containing phenolic structures, potentially leading to applications in pharmaceuticals or agrochemicals. Overall, its unique functional groups and structural features make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H8O4S
InChI:InChI=1S/C12H8O4S/c13-5-8-3-7(1-2-10(8)14)9-4-11(12(15)16)17-6-9/h1-6,14H,(H,15,16)
InChI key:InChIKey=XFOPQBYTQDWBMT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CS1)C2=CC(C=O)=C(O)C=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-(3-formyl-4-hydroxyphenyl)-
  • 4-(3-Formyl-4-hydroxyphenyl)-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.