CAS 1261944-09-5

Methyl 4′-chloro-3-fluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 4′-chloro-3-fluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylate group indicates that it is an ester, specifically a methyl ester, which contributes to its solubility in organic solvents. The compound features a chloro and a fluoro substituent, which can influence its reactivity and polarity. The hydroxy group adds to its potential for hydrogen bonding, affecting its physical properties such as boiling point and solubility in water. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and material science. Its specific interactions and applications would depend on the functional groups' positions and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogenated substituents, which can pose environmental and health risks.

Formula: C₁₄H₁₀ClFO₃

InChI: InChI=1S/C14H10ClFO3/c1-19-14(18)10-4-2-8(6-12(10)16)9-3-5-11(15)13(17)7-9/h2-7,17H,1H3

InChI key: InChIKey=XYINYZDTEONMEE-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(OC)=O)C2=CC(O)=C(Cl)C=C2

Synonyms:

• Methyl 4′-chloro-3-fluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 4′-chloro-3-fluoro-3′-hydroxy-, methyl ester