
CAS 1261944-23-3
:6-(2-Fluoro-4-methylphenyl)-3-pyridinol
Description:
6-(2-Fluoro-4-methylphenyl)-3-pyridinol, identified by its CAS number 1261944-23-3, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a fluoro-methylphenyl group. This compound typically exhibits characteristics common to pyridinol derivatives, such as potential biological activity due to the presence of the hydroxyl group, which can participate in hydrogen bonding and influence solubility and reactivity. The fluorine atom in the phenyl group can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. The presence of the methyl group on the phenyl ring may also influence steric hindrance and overall molecular conformation. Such compounds are often studied for their pharmacological properties, including antimicrobial or anti-inflammatory activities. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C12H10FNO
InChI:InChI=1S/C12H10FNO/c1-8-2-4-10(11(13)6-8)12-5-3-9(15)7-14-12/h2-7,15H,1H3
InChI key:InChIKey=VXWZGSVHABHHKC-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC=C(O)C=N2)C=CC(C)=C1
Synonyms:- 6-(2-Fluoro-4-methylphenyl)-3-pyridinol
- 3-Pyridinol, 6-(2-fluoro-4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.