CymitQuimica logo

CAS 1261944-24-4

:

2′,5-Difluoro[1,1′-biphenyl]-3,4′-diol

Description:
2′,5-Difluoro[1,1′-biphenyl]-3,4′-diol is an organic compound characterized by the presence of two fluorine atoms and two hydroxyl groups attached to a biphenyl structure. The biphenyl moiety consists of two phenyl rings connected by a single bond, which allows for some rotational freedom, influencing its physical and chemical properties. The difluorination at the 2′ and 5 positions introduces electron-withdrawing effects, potentially enhancing the compound's reactivity and altering its solubility in various solvents. The hydroxyl groups at the 3 and 4′ positions contribute to its polarity and can participate in hydrogen bonding, affecting its interactions with other molecules. This compound may exhibit interesting biological activities or serve as a precursor in synthetic chemistry due to its unique functional groups. Its specific applications and behavior in various chemical environments would depend on further studies, including its stability, reactivity, and potential uses in pharmaceuticals or materials science.
Formula:C12H8F2O2
InChI:InChI=1S/C12H8F2O2/c13-8-3-7(4-10(16)5-8)11-2-1-9(15)6-12(11)14/h1-6,15-16H
InChI key:InChIKey=XHYKVQSMDYQJSY-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(O)=C1)C2=CC(F)=CC(O)=C2
Synonyms:
  • 2′,5-Difluoro[1,1′-biphenyl]-3,4′-diol
  • [1,1′-Biphenyl]-3,4′-diol, 2′,5-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.