
CAS 1261944-30-2
:6-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol
Description:
6-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol, identified by its CAS number 1261944-30-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a phenolic group with a fluorine substituent. The presence of the hydroxyl (-OH) group on the phenyl ring contributes to its potential as a hydrogen bond donor, while the fluorine atom can enhance lipophilicity and influence the compound's reactivity and biological activity. This compound may exhibit properties typical of both pyridines and phenols, such as potential antioxidant activity or interactions with biological targets. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound's solubility and stability in different solvents can be influenced by the functional groups present, making it a candidate for further research in drug formulation and design.
Formula:C11H8FNO2
InChI:InChI=1S/C11H8FNO2/c12-7-1-3-9(11(15)5-7)10-4-2-8(14)6-13-10/h1-6,14-15H
InChI key:InChIKey=VIMMQJCHTOXGLV-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC=C(O)C=N2)C=CC(F)=C1
Synonyms:- 3-Pyridinol, 6-(4-fluoro-2-hydroxyphenyl)-
- 6-(4-Fluoro-2-hydroxyphenyl)-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.