CymitQuimica logo

CAS 1261944-32-4

:

3′-Chloro-N-ethyl-3-fluoro-5′-hydroxy[1,1′-biphenyl]-4-carboxamide

Description:
3′-Chloro-N-ethyl-3-fluoro-5′-hydroxy[1,1′-biphenyl]-4-carboxamide is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxamide functional group indicates that it has both amine and carbonyl characteristics, contributing to its potential as a bioactive molecule. The compound features a chloro and a fluoro substituent, which can significantly influence its chemical reactivity and biological activity. The hydroxyl group at the 5′ position enhances its polarity and solubility in polar solvents, potentially affecting its pharmacokinetics. The ethyl group at the nitrogen atom may contribute to the compound's lipophilicity, influencing its interaction with biological membranes. Overall, the unique combination of functional groups and structural features suggests that this compound may exhibit interesting properties, making it a candidate for further research in medicinal chemistry or related fields. However, specific biological activities and applications would require empirical investigation.
Formula:C15H13ClFNO2
InChI:InChI=1S/C15H13ClFNO2/c1-2-18-15(20)13-4-3-9(7-14(13)17)10-5-11(16)8-12(19)6-10/h3-8,19H,2H2,1H3,(H,18,20)
InChI key:InChIKey=NRGKEXZJYBOTJL-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(NCC)=O)C2=CC(Cl)=CC(O)=C2
Synonyms:
  • 3′-Chloro-N-ethyl-3-fluoro-5′-hydroxy[1,1′-biphenyl]-4-carboxamide
  • [1,1′-Biphenyl]-4-carboxamide, 3′-chloro-N-ethyl-3-fluoro-5′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.