CAS 1261944-38-0

2′,5-Difluoro[1,1′-biphenyl]-2,4′-diol

Description:

2′,5-Difluoro[1,1′-biphenyl]-2,4′-diol is an organic compound characterized by the presence of two fluorine atoms and two hydroxyl (–OH) groups attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with the fluorine substituents located at the 2′ and 5 positions of one ring, and the hydroxyl groups at the 2 and 4′ positions of the biphenyl system. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The hydroxyl groups contribute to the compound's potential as a hydrogen bond donor, which may affect its solubility and interactions in various chemical environments. This compound may have applications in fields such as materials science, pharmaceuticals, or as a potential intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would require experimental determination or reference to detailed chemical databases.

Formula: C₁₂H₈F₂O₂

InChI: InChI=1S/C12H8F2O2/c13-7-1-4-12(16)10(5-7)9-3-2-8(15)6-11(9)14/h1-6,15-16H

InChI key: InChIKey=YAXOSHJPTXAYEY-UHFFFAOYSA-N

SMILES: OC1=C(C=C(F)C=C1)C2=C(F)C=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-2,4′-diol, 2′,5-difluoro-
• 2′,5-Difluoro[1,1′-biphenyl]-2,4′-diol