CymitQuimica logo

CAS 1261944-39-1

:

5-Chloro-3′-hydroxy[1,1′-biphenyl]-2-carboxylic acid

Description:
5-Chloro-3′-hydroxy[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 5-position and a hydroxyl group at the 3′-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 2-position enhances its acidity and allows for hydrogen bonding, which can influence its interactions in biological systems and its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in various fields, including materials science and medicinal chemistry. Additionally, the presence of halogen and hydroxyl groups can affect its electronic properties, making it a candidate for further study in organic synthesis and drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H9ClO3
InChI:InChI=1S/C13H9ClO3/c14-9-4-5-11(13(16)17)12(7-9)8-2-1-3-10(15)6-8/h1-7,15H,(H,16,17)
InChI key:InChIKey=BFNYBPXWCFIUEA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(Cl)C=C1)C2=CC(O)=CC=C2
Synonyms:
  • 5-Chloro-3′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
  • [1,1′-Biphenyl]-2-carboxylic acid, 5-chloro-3′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.