
CAS 1261944-54-0
:1,2-Dihydro-5-(4-methylphenyl)-2-oxo-4-pyridinecarboxylic acid
Description:
1,2-Dihydro-5-(4-methylphenyl)-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring fused with a dihydro moiety and a carboxylic acid functional group. This compound features a 4-methylphenyl substituent, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of the keto group (2-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The carboxylic acid group suggests that the compound can exhibit acidic behavior, making it soluble in polar solvents. Its molecular structure may also allow for hydrogen bonding, which can affect its physical properties, such as melting point and boiling point. Additionally, the compound may have potential applications in pharmaceuticals or agrochemicals due to its structural features, which could interact with biological systems. However, specific biological activity or toxicity would require further investigation through experimental studies.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c1-8-2-4-9(5-3-8)11-7-14-12(15)6-10(11)13(16)17/h2-7H,1H3,(H,14,15)(H,16,17)
InChI key:InChIKey=JZZUAFGLARCMQS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CNC(=O)C1)C2=CC=C(C)C=C2
Synonyms:- 4-Pyridinecarboxylic acid, 1,2-dihydro-5-(4-methylphenyl)-2-oxo-
- 1,2-Dihydro-5-(4-methylphenyl)-2-oxo-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.