CAS 1261944-56-2

1,2-Dihydro-5-(2-hydroxyphenyl)-2-oxo-4-pyridinecarboxylic acid

Description:

1,2-Dihydro-5-(2-hydroxyphenyl)-2-oxo-4-pyridinecarboxylic acid, identified by its CAS number 1261944-56-2, is a chemical compound that features a pyridine ring substituted with a carboxylic acid and a hydroxylated phenyl group. This compound is characterized by its dual functional groups: the carboxylic acid group contributes to its acidity and potential reactivity, while the hydroxyl group on the phenyl ring can participate in hydrogen bonding and influence solubility and reactivity. The presence of the pyridine moiety suggests potential applications in medicinal chemistry, as pyridine derivatives are often found in pharmaceuticals. Additionally, the compound may exhibit biological activity, possibly acting as an enzyme inhibitor or interacting with biological targets due to its structural features. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, making it of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₉NO₄

InChI: InChI=1S/C12H9NO4/c14-10-4-2-1-3-7(10)9-6-13-11(15)5-8(9)12(16)17/h1-6,14H,(H,13,15)(H,16,17)

InChI key: InChIKey=VLMNNOHKSAAMPO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=C(O)C=CC=C2

Synonyms:

• 1,2-Dihydro-5-(2-hydroxyphenyl)-2-oxo-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 1,2-dihydro-5-(2-hydroxyphenyl)-2-oxo-