CAS 1261945-16-7

Methyl 3-chloro-3′-formyl-4′-hydroxy[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 3-chloro-3′-formyl-4′-hydroxy[1,1′-biphenyl]-4-carboxylate is a chemical compound characterized by its complex structure, which includes a biphenyl framework with various functional groups. This compound features a chloro substituent, a formyl group, a hydroxy group, and a carboxylate ester, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloro group may enhance electrophilic reactivity, while the hydroxy and carboxylate functionalities can participate in hydrogen bonding and other intermolecular interactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, Methyl 3-chloro-3′-formyl-4′-hydroxy[1,1′-biphenyl]-4-carboxylate represents a versatile structure for further research and application in various chemical fields.

Formula: C₁₅H₁₁ClO₄

InChI: InChI=1S/C15H11ClO4/c1-20-15(19)12-4-2-10(7-13(12)16)9-3-5-14(18)11(6-9)8-17/h2-8,18H,1H3

InChI key: InChIKey=DYXIHLYMYPHZSI-UHFFFAOYSA-N

SMILES: C(=O)C=1C=C(C=CC1O)C2=CC(Cl)=C(C(OC)=O)C=C2

Synonyms:

• Methyl 3-chloro-3′-formyl-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-3′-formyl-4′-hydroxy-, methyl ester