CymitQuimica logo

CAS 1261945-32-7

:

N-(1,1-Dimethylethyl)-3′-hydroxy[1,1′-biphenyl]-3-sulfonamide

Description:
N-(1,1-Dimethylethyl)-3′-hydroxy[1,1′-biphenyl]-3-sulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the biphenyl structure contributes to its stability and potential for various interactions in biological systems. The compound features a hydroxy group, which can enhance its solubility in polar solvents and may influence its reactivity and biological activity. The tert-butyl group (1,1-dimethylethyl) provides steric hindrance, which can affect the compound's binding affinity to biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its unique structure suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile. As with many sulfonamides, it may also be subject to regulatory scrutiny due to its chemical nature and potential environmental impact.
Formula:C16H19NO3S
InChI:InChI=1S/C16H19NO3S/c1-16(2,3)17-21(19,20)15-9-5-7-13(11-15)12-6-4-8-14(18)10-12/h4-11,17-18H,1-3H3
InChI key:InChIKey=CUKLBRYNONCYLX-UHFFFAOYSA-N
SMILES:S(NC(C)(C)C)(=O)(=O)C=1C=C(C=CC1)C2=CC(O)=CC=C2
Synonyms:
  • N-(1,1-Dimethylethyl)-3′-hydroxy[1,1′-biphenyl]-3-sulfonamide
  • [1,1′-Biphenyl]-3-sulfonamide, N-(1,1-dimethylethyl)-3′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.