CAS 1261945-45-2

6-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid

Description:

6-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid, with the CAS number 1261945-45-2, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a dimethylamino carbonyl moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions, including acid-base interactions. The presence of the dimethylamino group suggests potential for nucleophilic behavior, while the carboxylic acid functionality indicates acidic properties. The compound may also display solubility in polar solvents due to its functional groups. Its molecular structure allows for potential applications in pharmaceuticals, particularly in drug design, where modifications can enhance biological activity or selectivity. Additionally, the compound's unique characteristics may contribute to its utility in organic synthesis and as a building block in the development of more complex molecules. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₄N₂O₃

InChI: InChI=1S/C15H14N2O3/c1-17(2)14(18)11-5-3-4-10(8-11)13-7-6-12(9-16-13)15(19)20/h3-9H,1-2H3,(H,19,20)

InChI key: InChIKey=DVXYOXXCDSFLGY-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C=1C=C(C=CC1)C2=CC=C(C(O)=O)C=N2

Synonyms:

• 3-Pyridinecarboxylic acid, 6-[3-[(dimethylamino)carbonyl]phenyl]-
• 6-[3-[(Dimethylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid