CAS 1261945-48-5

3′-Chloro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-Chloro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, potentially participating in various chemical reactions, including esterification and acid-base reactions. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. The chlorine atom and the methyl group on the biphenyl framework contribute to the compound's unique electronic and steric properties, potentially affecting its solubility and interaction with biological systems. This compound may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or environmental impact.

Formula: C₁₅H₁₀ClF₃O₂

InChI: InChI=1S/C15H10ClF3O2/c1-8-12(3-2-4-13(8)16)9-5-10(14(20)21)7-11(6-9)15(17,18)19/h2-7H,1H3,(H,20,21)

InChI key: InChIKey=PORURIXJLAUOLZ-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(F)(F)F)=CC(C(O)=O)=C2)C=CC=C1Cl

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 3′-chloro-2′-methyl-5-(trifluoromethyl)-
• 3′-Chloro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid