CAS 1261945-63-4

Methyl 4-chloro-3-(1,2-dihydro-2-oxo-3-pyridinyl)benzoate

Description:

Methyl 4-chloro-3-(1,2-dihydro-2-oxo-3-pyridinyl)benzoate is a chemical compound characterized by its complex structure, which includes a benzoate moiety and a pyridine derivative. The presence of a chlorine atom at the para position of the benzoate ring contributes to its reactivity and potential biological activity. The 1,2-dihydro-2-oxo-3-pyridinyl group suggests that the compound may exhibit properties typical of pyridine derivatives, such as potential pharmacological effects. This compound is likely to be a solid at room temperature and may be soluble in organic solvents due to its aromatic and polar functional groups. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific interactions and reactivity of this compound would depend on its functional groups and the overall electronic environment, making it a subject of interest for further research in organic synthesis and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c1-18-13(17)8-4-5-11(14)10(7-8)9-3-2-6-15-12(9)16/h2-7H,1H3,(H,15,16)

InChI key: InChIKey=WTPJRZNUSFSKRM-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(OC)=O)=CC1)C=2C(=O)NC=CC2

Synonyms:

• Benzoic acid, 4-chloro-3-(1,2-dihydro-2-oxo-3-pyridinyl)-, methyl ester
• Methyl 4-chloro-3-(1,2-dihydro-2-oxo-3-pyridinyl)benzoate