CymitQuimica logo

CAS 1261945-78-1

:

2-[2-(Phenylmethoxy)phenyl]-3-pyridinol

Description:
2-[2-(Phenylmethoxy)phenyl]-3-pyridinol, identified by its CAS number 1261945-78-1, is an organic compound characterized by its complex molecular structure, which includes a pyridine ring and phenyl groups. This compound features a pyridinol moiety, indicating the presence of a hydroxyl group (-OH) attached to the pyridine ring, which can influence its solubility and reactivity. The phenylmethoxy substituent enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. The presence of multiple aromatic rings suggests that it may exhibit significant π-π stacking interactions, which can affect its physical properties, such as melting point and solubility in organic solvents. Additionally, the compound may possess various functional groups that can participate in hydrogen bonding, further influencing its chemical behavior. Overall, 2-[2-(Phenylmethoxy)phenyl]-3-pyridinol is a compound with potential applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c20-16-10-6-12-19-18(16)15-9-4-5-11-17(15)21-13-14-7-2-1-3-8-14/h1-12,20H,13H2
InChI key:InChIKey=HFKBEYXNAXHCER-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C=CC=C2)C3=C(O)C=CC=N3
Synonyms:
  • 2-[2-(Phenylmethoxy)phenyl]-3-pyridinol
  • 3-Pyridinol, 2-[2-(phenylmethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.