CAS 1261946-24-0

1,6-Dihydro-5-[2-(hydroxymethyl)phenyl]-6-oxo-3-pyridinecarboxylic acid

Description:

1,6-Dihydro-5-[2-(hydroxymethyl)phenyl]-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features a hydroxymethyl group attached to a phenyl ring, contributing to its potential reactivity and solubility properties. The presence of the keto group (6-oxo) and the carboxylic acid enhances its acidity and may influence its interactions in biological systems. The molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Additionally, the compound's unique arrangement of functional groups may allow for various synthetic modifications, making it a candidate for further research in medicinal chemistry. Its CAS number, 1261946-24-0, provides a unique identifier for regulatory and safety information, facilitating its study and application in various chemical contexts.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1S/C13H11NO4/c15-7-8-3-1-2-4-10(8)11-5-9(13(17)18)6-14-12(11)16/h1-6,15H,7H2,(H,14,16)(H,17,18)

InChI key: InChIKey=ISRXAACVCLNVNN-UHFFFAOYSA-N

SMILES: C(O)C1=C(C=CC=C1)C2=CC(C(O)=O)=CNC2=O

Synonyms:

• 3-Pyridinecarboxylic acid, 1,6-dihydro-5-[2-(hydroxymethyl)phenyl]-6-oxo-
• 1,6-Dihydro-5-[2-(hydroxymethyl)phenyl]-6-oxo-3-pyridinecarboxylic acid