CAS 1261946-49-9

2-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:

2-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261946-49-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a fluorine atom and a methoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential acidity due to the carboxylic acid functional group. The presence of the fluorine atom can influence its reactivity and polarity, while the methoxycarbonyl group may enhance its solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, its unique combination of substituents may impart specific biological activities, making it a candidate for further research in drug discovery and development.

Formula: C₁₄H₁₀FNO₄

InChI: InChI=1S/C14H10FNO4/c1-20-14(19)8-4-5-11(15)10(7-8)12-9(13(17)18)3-2-6-16-12/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=MTDYRLDRVPXBIS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=CC=C1)C2=CC(C(OC)=O)=CC=C2F

Synonyms:

• 3-Pyridinecarboxylic acid, 2-[2-fluoro-5-(methoxycarbonyl)phenyl]-
• 2-[2-Fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid