
CAS 1261946-52-4
:2′,5-Dichloro-5′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
Description:
2′,5-Dichloro-5′-hydroxy[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine substituents at the 2′ and 5′ positions of one phenyl ring, and a hydroxyl group at the 5′ position, contributing to its potential reactivity and solubility properties. The presence of a carboxylic acid functional group at the 2-position enhances its acidity and polar character, making it more soluble in polar solvents. The dichloro and hydroxy groups can influence the compound's biological activity, potentially affecting its interactions with various biological systems. This compound may be of interest in fields such as medicinal chemistry, environmental science, or materials science due to its unique structural features and potential applications. As with many chlorinated compounds, considerations regarding toxicity and environmental impact are important for its handling and use.
Formula:C13H8Cl2O3
InChI:InChI=1S/C13H8Cl2O3/c14-7-1-3-9(13(17)18)10(5-7)11-6-8(16)2-4-12(11)15/h1-6,16H,(H,17,18)
InChI key:InChIKey=LEZCWVPZAKISLF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(Cl)C=C1)C2=C(Cl)C=CC(O)=C2
Synonyms:- 2′,5-Dichloro-5′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 2′,5-dichloro-5′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.